C24H36N4O2 — CID 42843871
1-[[5-(4-methylpiperazin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl-propylamino]hex-5-en-2-ol (PubChem CID 42843871) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 1-[[5-(4-methylpiperazin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl-propylamino]hex-5-en-2-ol.
| Compound Name | 1-[[5-(4-methylpiperazin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl-propylamino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 42843871 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 1-[[5-(4-methylpiperazin-1-yl)-3-phenyl-1,2-oxazol-4-yl]methyl-propylamino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN(CCC)Cc1c(-c2ccccc2)noc1N1CCN(C)CC1 |
| InChI | InChI=1S/C24H36N4O2/c1-4-6-12-21(29)18-27(13-5-2)19-22-23(20-10-8-7-9-11-20)25-30-24(22)28-16-14-26(3)15-17-28/h4,7-11,21,29H,1,5-6,12-19H2,2-3H3 |
| InChIKey | FZMFEZKBRRZVIO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|