C26H38N4O5 — CID 93207990
(2S)-1-[2-morpholin-4-ylethyl-[(5-morpholin-4-yl-3-phenyl-1,2-oxazol-4-yl)methyl]amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 93207990) has the molecular formula C26H38N4O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is (2S)-1-[2-morpholin-4-ylethyl-[(5-morpholin-4-yl-3-phenyl-1,2-oxazol-4-yl)methyl]amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2S)-1-[2-morpholin-4-ylethyl-[(5-morpholin-4-yl-3-phenyl-1,2-oxazol-4-yl)methyl]amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 93207990 |
| Molecular Formula | C26H38N4O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | (2S)-1-[2-morpholin-4-ylethyl-[(5-morpholin-4-yl-3-phenyl-1,2-oxazol-4-yl)methyl]amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@@H](O)CN(CCN1CCOCC1)Cc1c(-c2ccccc2)noc1N1CCOCC1 |
| InChI | InChI=1S/C26H38N4O5/c1-2-14-34-21-23(31)19-29(9-8-28-10-15-32-16-11-28)20-24-25(22-6-4-3-5-7-22)27-35-26(24)30-12-17-33-18-13-30/h2-7,23,31H,1,8-21H2/t23-/m0/s1 |
| InChIKey | YYWGMTFGSUUVAD-QHCPKHFHSA-N |
| XLogP | 1.88 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|