C27H35N3O4 — CID 42844308
1-[[3-ethyl-5-(4-methoxyphenoxy)-1-phenylpyrazol-4-yl]methyl-(2-methoxyethyl)amino]-2-methylbut-3-en-2-ol (PubChem CID 42844308) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is 1-[[3-ethyl-5-(4-methoxyphenoxy)-1-phenylpyrazol-4-yl]methyl-(2-methoxyethyl)amino]-2-methylbut-3-en-2-ol.
| Compound Name | 1-[[3-ethyl-5-(4-methoxyphenoxy)-1-phenylpyrazol-4-yl]methyl-(2-methoxyethyl)amino]-2-methylbut-3-en-2-ol |
|---|---|
| PubChem CID | 42844308 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 1-[[3-ethyl-5-(4-methoxyphenoxy)-1-phenylpyrazol-4-yl]methyl-(2-methoxyethyl)amino]-2-methylbut-3-en-2-ol |
| SMILES | C=CC(C)(O)CN(CCOC)Cc1c(CC)nn(-c2ccccc2)c1Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C27H35N3O4/c1-6-25-24(19-29(17-18-32-4)20-27(3,31)7-2)26(30(28-25)21-11-9-8-10-12-21)34-23-15-13-22(33-5)14-16-23/h7-16,31H,2,6,17-20H2,1,3-5H3 |
| InChIKey | NOAZMNBOSUGPLY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|