C27H37N3O3 — CID 46028267
1-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-(2-methoxyethyl)amino]hexan-2-ol (PubChem CID 46028267) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is 1-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-(2-methoxyethyl)amino]hexan-2-ol.
| Compound Name | 1-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-(2-methoxyethyl)amino]hexan-2-ol |
|---|---|
| PubChem CID | 46028267 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 1-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-(2-methoxyethyl)amino]hexan-2-ol |
| SMILES | CCCCC(O)CN(CCOC)Cc1c(CC)nn(-c2ccccc2)c1Oc1ccccc1 |
| InChI | InChI=1S/C27H37N3O3/c1-4-6-15-23(31)20-29(18-19-32-3)21-25-26(5-2)28-30(22-13-9-7-10-14-22)27(25)33-24-16-11-8-12-17-24/h7-14,16-17,23,31H,4-6,15,18-21H2,1-3H3 |
| InChIKey | HYNMMVMMAHQOCS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |