C26H35N3O3 — CID 46029352
1-ethoxy-3-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-propylamino]propan-2-ol (PubChem CID 46029352) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 1-ethoxy-3-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-propylamino]propan-2-ol.
| Compound Name | 1-ethoxy-3-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-propylamino]propan-2-ol |
|---|---|
| PubChem CID | 46029352 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 1-ethoxy-3-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-propylamino]propan-2-ol |
| SMILES | CCCN(Cc1c(CC)nn(-c2ccccc2)c1Oc1ccccc1)CC(O)COCC |
| InChI | InChI=1S/C26H35N3O3/c1-4-17-28(18-22(30)20-31-6-3)19-24-25(5-2)27-29(21-13-9-7-10-14-21)26(24)32-23-15-11-8-12-16-23/h7-16,22,30H,4-6,17-20H2,1-3H3 |
| InChIKey | XPHHMSSPZGXWHD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |