C24H31N3O2 — CID 93224361
(2R)-1-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-propylamino]propan-2-ol (PubChem CID 93224361) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is (2R)-1-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-propylamino]propan-2-ol.
| Compound Name | (2R)-1-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-propylamino]propan-2-ol |
|---|---|
| PubChem CID | 93224361 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | (2R)-1-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-propylamino]propan-2-ol |
| SMILES | CCCN(Cc1c(CC)nn(-c2ccccc2)c1Oc1ccccc1)C[C@@H](C)O |
| InChI | InChI=1S/C24H31N3O2/c1-4-16-26(17-19(3)28)18-22-23(5-2)25-27(20-12-8-6-9-13-20)24(22)29-21-14-10-7-11-15-21/h6-15,19,28H,4-5,16-18H2,1-3H3/t19-/m1/s1 |
| InChIKey | OIMKCVUZZNBEAA-LJQANCHMSA-N |
| XLogP | 4.82 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |