C26H29N3O3 — CID 46029413
1-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-(furan-2-ylmethyl)amino]propan-2-ol (PubChem CID 46029413) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 1-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-(furan-2-ylmethyl)amino]propan-2-ol.
| Compound Name | 1-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-(furan-2-ylmethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 46029413 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 1-[(3-ethyl-5-phenoxy-1-phenylpyrazol-4-yl)methyl-(furan-2-ylmethyl)amino]propan-2-ol |
| SMILES | CCc1nn(-c2ccccc2)c(Oc2ccccc2)c1CN(Cc1ccco1)CC(C)O |
| InChI | InChI=1S/C26H29N3O3/c1-3-25-24(19-28(17-20(2)30)18-23-15-10-16-31-23)26(32-22-13-8-5-9-14-22)29(27-25)21-11-6-4-7-12-21/h4-16,20,30H,3,17-19H2,1-2H3 |
| InChIKey | LRRXJKOFCAANLZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |