C25H31N5O4 — CID 42848245
N-[1-[2-(4-ethylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-4-nitrobenzamide (PubChem CID 42848245) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[1-[2-(4-ethylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-4-nitrobenzamide.
| Compound Name | N-[1-[2-(4-ethylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 42848245 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | N-[1-[2-(4-ethylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-4-nitrobenzamide |
| SMILES | CCN1CCN(C(=O)c2ccccc2N2CCC(NC(=O)c3ccc([N+](=O)[O-])cc3)CC2)CC1 |
| InChI | InChI=1S/C25H31N5O4/c1-2-27-15-17-29(18-16-27)25(32)22-5-3-4-6-23(22)28-13-11-20(12-14-28)26-24(31)19-7-9-21(10-8-19)30(33)34/h3-10,20H,2,11-18H2,1H3,(H,26,31) |
| InChIKey | SLADVOWHCGFJEO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|