C29H38N4O3 — CID 46038397
N-[1-[2-(4-cyclopentylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-4-methoxybenzamide (PubChem CID 46038397) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is N-[1-[2-(4-cyclopentylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-4-methoxybenzamide.
| Compound Name | N-[1-[2-(4-cyclopentylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 46038397 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | N-[1-[2-(4-cyclopentylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCN(c3ccccc3C(=O)N3CCN(C4CCCC4)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H38N4O3/c1-36-25-12-10-22(11-13-25)28(34)30-23-14-16-32(17-15-23)27-9-5-4-8-26(27)29(35)33-20-18-31(19-21-33)24-6-2-3-7-24/h4-5,8-13,23-24H,2-3,6-7,14-21H2,1H3,(H,30,34) |
| InChIKey | KGOMBZZCOHIARO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |