C30H39FN4O2 — CID 46038445
N-[1-[2-(4-cycloheptylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-3-fluorobenzamide (PubChem CID 46038445) has the molecular formula C30H39FN4O2 and a molecular weight of 506.67 g/mol. Its IUPAC name is N-[1-[2-(4-cycloheptylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-3-fluorobenzamide.
| Compound Name | N-[1-[2-(4-cycloheptylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 46038445 |
| Molecular Formula | C30H39FN4O2 |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | N-[1-[2-(4-cycloheptylpiperazine-1-carbonyl)phenyl]piperidin-4-yl]-3-fluorobenzamide |
| SMILES | O=C(NC1CCN(c2ccccc2C(=O)N2CCN(C3CCCCCC3)CC2)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C30H39FN4O2/c31-24-9-7-8-23(22-24)29(36)32-25-14-16-34(17-15-25)28-13-6-5-12-27(28)30(37)35-20-18-33(19-21-35)26-10-3-1-2-4-11-26/h5-9,12-13,22,25-26H,1-4,10-11,14-21H2,(H,32,36) |
| InChIKey | DUZFJSOTOGRUEY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |