C22H29N3O3S — CID 42848513
2-[4-(benzenesulfonamido)piperidin-1-yl]-N-butan-2-ylbenzamide (PubChem CID 42848513) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 2-[4-(benzenesulfonamido)piperidin-1-yl]-N-butan-2-ylbenzamide.
| Compound Name | 2-[4-(benzenesulfonamido)piperidin-1-yl]-N-butan-2-ylbenzamide |
|---|---|
| PubChem CID | 42848513 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-[4-(benzenesulfonamido)piperidin-1-yl]-N-butan-2-ylbenzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1N1CCC(NS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N3O3S/c1-3-17(2)23-22(26)20-11-7-8-12-21(20)25-15-13-18(14-16-25)24-29(27,28)19-9-5-4-6-10-19/h4-12,17-18,24H,3,13-16H2,1-2H3,(H,23,26) |
| InChIKey | YOJBUBSQGMZJJL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |