C24H25ClN4O3S — CID 46038683
2-[4-[(4-chlorophenyl)sulfonylamino]piperidin-1-yl]-N-(pyridin-4-ylmethyl)benzamide (PubChem CID 46038683) has the molecular formula C24H25ClN4O3S and a molecular weight of 485.01 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)sulfonylamino]piperidin-1-yl]-N-(pyridin-4-ylmethyl)benzamide.
| Compound Name | 2-[4-[(4-chlorophenyl)sulfonylamino]piperidin-1-yl]-N-(pyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 46038683 |
| Molecular Formula | C24H25ClN4O3S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)sulfonylamino]piperidin-1-yl]-N-(pyridin-4-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccncc1)c1ccccc1N1CCC(NS(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H25ClN4O3S/c25-19-5-7-21(8-6-19)33(31,32)28-20-11-15-29(16-12-20)23-4-2-1-3-22(23)24(30)27-17-18-9-13-26-14-10-18/h1-10,13-14,20,28H,11-12,15-17H2,(H,27,30) |
| InChIKey | WVLDWUQVHRGDBH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |