C16H11ClF5NO4S — CID 42851119
(2,3,4,5,6-pentafluorophenyl) 3-(2-chlorophenyl)-2-methyl-1,2-oxazolidine-4-sulfonate (PubChem CID 42851119) has the molecular formula C16H11ClF5NO4S and a molecular weight of 443.78 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-(2-chlorophenyl)-2-methyl-1,2-oxazolidine-4-sulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-(2-chlorophenyl)-2-methyl-1,2-oxazolidine-4-sulfonate |
|---|---|
| PubChem CID | 42851119 |
| Molecular Formula | C16H11ClF5NO4S |
| Molecular Weight | 443.78 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-(2-chlorophenyl)-2-methyl-1,2-oxazolidine-4-sulfonate |
| SMILES | CN1OCC(S(=O)(=O)Oc2c(F)c(F)c(F)c(F)c2F)C1c1ccccc1Cl |
| InChI | InChI=1S/C16H11ClF5NO4S/c1-23-15(7-4-2-3-5-8(7)17)9(6-26-23)28(24,25)27-16-13(21)11(19)10(18)12(20)14(16)22/h2-5,9,15H,6H2,1H3 |
| InChIKey | NCLHJAAAKACVDR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|