C25H27FN4O2 — CID 42857339
2-(4-fluorophenyl)-N-[6-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]-3-pyridinyl]acetamide (PubChem CID 42857339) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[6-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]-3-pyridinyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[6-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 42857339 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[6-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]-3-pyridinyl]acetamide |
| SMILES | COc1ccccc1CN1CCN(c2ccc(NC(=O)Cc3ccc(F)cc3)cn2)CC1 |
| InChI | InChI=1S/C25H27FN4O2/c1-32-23-5-3-2-4-20(23)18-29-12-14-30(15-13-29)24-11-10-22(17-27-24)28-25(31)16-19-6-8-21(26)9-7-19/h2-11,17H,12-16,18H2,1H3,(H,28,31) |
| InChIKey | ADTZQSMZYUPSRM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |