C25H28FN5O2 — CID 42857738
1-(2-ethoxyphenyl)-3-[6-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-3-pyridinyl]urea (PubChem CID 42857738) has the molecular formula C25H28FN5O2 and a molecular weight of 449.53 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-[6-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-3-pyridinyl]urea.
| Compound Name | 1-(2-ethoxyphenyl)-3-[6-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 42857738 |
| Molecular Formula | C25H28FN5O2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-[6-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-3-pyridinyl]urea |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc(N2CCN(Cc3ccc(F)cc3)CC2)nc1 |
| InChI | InChI=1S/C25H28FN5O2/c1-2-33-23-6-4-3-5-22(23)29-25(32)28-21-11-12-24(27-17-21)31-15-13-30(14-16-31)18-19-7-9-20(26)10-8-19/h3-12,17H,2,13-16,18H2,1H3,(H2,28,29,32) |
| InChIKey | YCNZWXVOOAOMIX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |