C19H23FN4O2 — CID 55794563
1-(2-ethoxy-4-fluorophenyl)-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]urea (PubChem CID 55794563) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-(2-ethoxy-4-fluorophenyl)-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]urea.
| Compound Name | 1-(2-ethoxy-4-fluorophenyl)-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 55794563 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 1-(2-ethoxy-4-fluorophenyl)-3-[(6-pyrrolidin-1-yl-3-pyridinyl)methyl]urea |
| SMILES | CCOc1cc(F)ccc1NC(=O)NCc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C19H23FN4O2/c1-2-26-17-11-15(20)6-7-16(17)23-19(25)22-13-14-5-8-18(21-12-14)24-9-3-4-10-24/h5-8,11-12H,2-4,9-10,13H2,1H3,(H2,22,23,25) |
| InChIKey | QNEGQVHNRMMWBW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |