C21H25ClFN3O2 — CID 55972764
N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(2-chloro-4-fluorophenoxy)propanamide (PubChem CID 55972764) has the molecular formula C21H25ClFN3O2 and a molecular weight of 405.90 g/mol. Its IUPAC name is N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(2-chloro-4-fluorophenoxy)propanamide.
| Compound Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(2-chloro-4-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 55972764 |
| Molecular Formula | C21H25ClFN3O2 |
| Molecular Weight | 405.90 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-[[6-(azepan-1-yl)-3-pyridinyl]methyl]-3-(2-chloro-4-fluorophenoxy)propanamide |
| SMILES | O=C(CCOc1ccc(F)cc1Cl)NCc1ccc(N2CCCCCC2)nc1 |
| InChI | InChI=1S/C21H25ClFN3O2/c22-18-13-17(23)6-7-19(18)28-12-9-21(27)25-15-16-5-8-20(24-14-16)26-10-3-1-2-4-11-26/h5-8,13-14H,1-4,9-12,15H2,(H,25,27) |
| InChIKey | LYCYYZGSPKUHOI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.90 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |