C20H24ClN3O2 — CID 55745410
2-(4-chloro-3-methylphenoxy)-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]acetamide (PubChem CID 55745410) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]acetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]acetamide |
|---|---|
| PubChem CID | 55745410 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[(6-piperidin-1-yl-3-pyridinyl)methyl]acetamide |
| SMILES | Cc1cc(OCC(=O)NCc2ccc(N3CCCCC3)nc2)ccc1Cl |
| InChI | InChI=1S/C20H24ClN3O2/c1-15-11-17(6-7-18(15)21)26-14-20(25)23-13-16-5-8-19(22-12-16)24-9-3-2-4-10-24/h5-8,11-12H,2-4,9-10,13-14H2,1H3,(H,23,25) |
| InChIKey | SXAKTRXDJDOUIO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |