C22H25N5O2S — CID 42857732
1-(4-methoxyphenyl)-3-[6-[4-(thiophen-3-ylmethyl)piperazin-1-yl]-3-pyridinyl]urea (PubChem CID 42857732) has the molecular formula C22H25N5O2S and a molecular weight of 423.54 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[6-[4-(thiophen-3-ylmethyl)piperazin-1-yl]-3-pyridinyl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[6-[4-(thiophen-3-ylmethyl)piperazin-1-yl]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 42857732 |
| Molecular Formula | C22H25N5O2S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[6-[4-(thiophen-3-ylmethyl)piperazin-1-yl]-3-pyridinyl]urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(N3CCN(Cc4ccsc4)CC3)nc2)cc1 |
| InChI | InChI=1S/C22H25N5O2S/c1-29-20-5-2-18(3-6-20)24-22(28)25-19-4-7-21(23-14-19)27-11-9-26(10-12-27)15-17-8-13-30-16-17/h2-8,13-14,16H,9-12,15H2,1H3,(H2,24,25,28) |
| InChIKey | KPBNPWHJHBTUEH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |