C25H26ClN3O2 — CID 42858106
3-chloro-N-(3-methoxyphenyl)-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide (PubChem CID 42858106) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 3-chloro-N-(3-methoxyphenyl)-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide.
| Compound Name | 3-chloro-N-(3-methoxyphenyl)-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 42858106 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-chloro-N-(3-methoxyphenyl)-N-[1-(pyridin-2-ylmethyl)piperidin-4-yl]benzamide |
| SMILES | COc1cccc(N(C(=O)c2cccc(Cl)c2)C2CCN(Cc3ccccn3)CC2)c1 |
| InChI | InChI=1S/C25H26ClN3O2/c1-31-24-10-5-9-23(17-24)29(25(30)19-6-4-7-20(26)16-19)22-11-14-28(15-12-22)18-21-8-2-3-13-27-21/h2-10,13,16-17,22H,11-12,14-15,18H2,1H3 |
| InChIKey | KBQDXHHWUWKUPK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |