C23H28ClN3O4 — CID 42858438
N-[1-[(2-chloro-5-nitrophenyl)methyl]piperidin-4-yl]-N-(3-methoxyphenyl)-2-methylpropanamide (PubChem CID 42858438) has the molecular formula C23H28ClN3O4 and a molecular weight of 445.95 g/mol. Its IUPAC name is N-[1-[(2-chloro-5-nitrophenyl)methyl]piperidin-4-yl]-N-(3-methoxyphenyl)-2-methylpropanamide.
| Compound Name | N-[1-[(2-chloro-5-nitrophenyl)methyl]piperidin-4-yl]-N-(3-methoxyphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 42858438 |
| Molecular Formula | C23H28ClN3O4 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[1-[(2-chloro-5-nitrophenyl)methyl]piperidin-4-yl]-N-(3-methoxyphenyl)-2-methylpropanamide |
| SMILES | COc1cccc(N(C(=O)C(C)C)C2CCN(Cc3cc([N+](=O)[O-])ccc3Cl)CC2)c1 |
| InChI | InChI=1S/C23H28ClN3O4/c1-16(2)23(28)26(19-5-4-6-21(14-19)31-3)18-9-11-25(12-10-18)15-17-13-20(27(29)30)7-8-22(17)24/h4-8,13-14,16,18H,9-12,15H2,1-3H3 |
| InChIKey | BHBHCNKPZQTWFN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|