C26H31FN2O4 — CID 42860205
2-[[2-(cyclopropanecarbonyl)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]-N-(2-methoxyethyl)butanamide (PubChem CID 42860205) has the molecular formula C26H31FN2O4 and a molecular weight of 454.54 g/mol. Its IUPAC name is 2-[[2-(cyclopropanecarbonyl)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]-N-(2-methoxyethyl)butanamide.
| Compound Name | 2-[[2-(cyclopropanecarbonyl)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]-N-(2-methoxyethyl)butanamide |
|---|---|
| PubChem CID | 42860205 |
| Molecular Formula | C26H31FN2O4 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-[[2-(cyclopropanecarbonyl)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]-N-(2-methoxyethyl)butanamide |
| SMILES | CCC(Oc1ccc2c(c1)C(c1ccc(F)cc1)N(C(=O)C1CC1)CC2)C(=O)NCCOC |
| InChI | InChI=1S/C26H31FN2O4/c1-3-23(25(30)28-13-15-32-2)33-21-11-8-17-12-14-29(26(31)19-4-5-19)24(22(17)16-21)18-6-9-20(27)10-7-18/h6-11,16,19,23-24H,3-5,12-15H2,1-2H3,(H,28,30) |
| InChIKey | SMHQLTPXUTYIAB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|