C27H34N2O4 — CID 46057666
2-[[2-(cyclopropanecarbonyl)-1-(4-methylphenyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]-N-(2-methoxyethyl)butanamide (PubChem CID 46057666) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-[[2-(cyclopropanecarbonyl)-1-(4-methylphenyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]-N-(2-methoxyethyl)butanamide.
| Compound Name | 2-[[2-(cyclopropanecarbonyl)-1-(4-methylphenyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]-N-(2-methoxyethyl)butanamide |
|---|---|
| PubChem CID | 46057666 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 2-[[2-(cyclopropanecarbonyl)-1-(4-methylphenyl)-3,4-dihydro-1H-isoquinolin-7-yl]oxy]-N-(2-methoxyethyl)butanamide |
| SMILES | CCC(Oc1ccc2c(c1)C(c1ccc(C)cc1)N(C(=O)C1CC1)CC2)C(=O)NCCOC |
| InChI | InChI=1S/C27H34N2O4/c1-4-24(26(30)28-14-16-32-3)33-22-12-11-19-13-15-29(27(31)21-9-10-21)25(23(19)17-22)20-7-5-18(2)6-8-20/h5-8,11-12,17,21,24-25H,4,9-10,13-16H2,1-3H3,(H,28,30) |
| InChIKey | CQRDKHCDULAALT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|