C25H31N3O3 — CID 42861510
1-[4-[[4-(2-methylbenzoyl)morpholin-2-yl]methyl]piperazin-1-yl]-2-phenylethanone (PubChem CID 42861510) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-[4-[[4-(2-methylbenzoyl)morpholin-2-yl]methyl]piperazin-1-yl]-2-phenylethanone.
| Compound Name | 1-[4-[[4-(2-methylbenzoyl)morpholin-2-yl]methyl]piperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 42861510 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 1-[4-[[4-(2-methylbenzoyl)morpholin-2-yl]methyl]piperazin-1-yl]-2-phenylethanone |
| SMILES | Cc1ccccc1C(=O)N1CCOC(CN2CCN(C(=O)Cc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C25H31N3O3/c1-20-7-5-6-10-23(20)25(30)28-15-16-31-22(19-28)18-26-11-13-27(14-12-26)24(29)17-21-8-3-2-4-9-21/h2-10,22H,11-19H2,1H3 |
| InChIKey | OBMLWEZKBVDWOY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |