C25H32N4O3 — CID 42862634
2-[[4-(naphthalene-1-carbonyl)-1,4-diazepan-1-yl]methyl]-N-prop-2-enylmorpholine-4-carboxamide (PubChem CID 42862634) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[[4-(naphthalene-1-carbonyl)-1,4-diazepan-1-yl]methyl]-N-prop-2-enylmorpholine-4-carboxamide.
| Compound Name | 2-[[4-(naphthalene-1-carbonyl)-1,4-diazepan-1-yl]methyl]-N-prop-2-enylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 42862634 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 2-[[4-(naphthalene-1-carbonyl)-1,4-diazepan-1-yl]methyl]-N-prop-2-enylmorpholine-4-carboxamide |
| SMILES | C=CCNC(=O)N1CCOC(CN2CCCN(C(=O)c3cccc4ccccc34)CC2)C1 |
| InChI | InChI=1S/C25H32N4O3/c1-2-11-26-25(31)29-16-17-32-21(19-29)18-27-12-6-13-28(15-14-27)24(30)23-10-5-8-20-7-3-4-9-22(20)23/h2-5,7-10,21H,1,6,11-19H2,(H,26,31) |
| InChIKey | ZEYZRKPVWIPFJQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|