C21H25N3O6S — CID 4286298
4-methoxy-N'-[2-(2-methylphenoxy)acetyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide (PubChem CID 4286298) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is 4-methoxy-N'-[2-(2-methylphenoxy)acetyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide.
| Compound Name | 4-methoxy-N'-[2-(2-methylphenoxy)acetyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 4286298 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 4-methoxy-N'-[2-(2-methylphenoxy)acetyl]-3-pyrrolidin-1-ylsulfonylbenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)COc2ccccc2C)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C21H25N3O6S/c1-15-7-3-4-8-17(15)30-14-20(25)22-23-21(26)16-9-10-18(29-2)19(13-16)31(27,28)24-11-5-6-12-24/h3-4,7-10,13H,5-6,11-12,14H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | GUWSTEABKLOZEK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|