C22H24F2N2O — CID 42863664
(4-fluorophenyl)-[3-(4-fluorophenyl)-4-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 42863664) has the molecular formula C22H24F2N2O and a molecular weight of 370.44 g/mol. Its IUPAC name is (4-fluorophenyl)-[3-(4-fluorophenyl)-4-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[3-(4-fluorophenyl)-4-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 42863664 |
| Molecular Formula | C22H24F2N2O |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | (4-fluorophenyl)-[3-(4-fluorophenyl)-4-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CC(CN2CCCC2)C(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H24F2N2O/c23-19-7-3-16(4-8-19)21-15-26(14-18(21)13-25-11-1-2-12-25)22(27)17-5-9-20(24)10-6-17/h3-10,18,21H,1-2,11-15H2 |
| InChIKey | CEDRVXLIJGBYBW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |