C23H33FN2O — CID 46062674
2-cyclopentyl-1-[3-(4-fluorophenyl)-4-(piperidin-1-ylmethyl)pyrrolidin-1-yl]ethanone (PubChem CID 46062674) has the molecular formula C23H33FN2O and a molecular weight of 372.53 g/mol. Its IUPAC name is 2-cyclopentyl-1-[3-(4-fluorophenyl)-4-(piperidin-1-ylmethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-cyclopentyl-1-[3-(4-fluorophenyl)-4-(piperidin-1-ylmethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 46062674 |
| Molecular Formula | C23H33FN2O |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 2-cyclopentyl-1-[3-(4-fluorophenyl)-4-(piperidin-1-ylmethyl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(CC1CCCC1)N1CC(CN2CCCCC2)C(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H33FN2O/c24-21-10-8-19(9-11-21)22-17-26(23(27)14-18-6-2-3-7-18)16-20(22)15-25-12-4-1-5-13-25/h8-11,18,20,22H,1-7,12-17H2 |
| InChIKey | KKCKDGTXPMEQFK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |