C25H31FN2O2 — CID 42863797
methyl 3-[(4-benzylpiperidin-1-yl)methyl]-4-(3-fluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 42863797) has the molecular formula C25H31FN2O2 and a molecular weight of 410.53 g/mol. Its IUPAC name is methyl 3-[(4-benzylpiperidin-1-yl)methyl]-4-(3-fluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | methyl 3-[(4-benzylpiperidin-1-yl)methyl]-4-(3-fluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 42863797 |
| Molecular Formula | C25H31FN2O2 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | methyl 3-[(4-benzylpiperidin-1-yl)methyl]-4-(3-fluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CC(CN2CCC(Cc3ccccc3)CC2)C(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C25H31FN2O2/c1-30-25(29)28-17-22(24(18-28)21-8-5-9-23(26)15-21)16-27-12-10-20(11-13-27)14-19-6-3-2-4-7-19/h2-9,15,20,22,24H,10-14,16-18H2,1H3 |
| InChIKey | HIWHWZJPDXEOHO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |