C28H28F2N4O3 — CID 42863805
[3-(3-fluorophenyl)-4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 42863805) has the molecular formula C28H28F2N4O3 and a molecular weight of 506.55 g/mol. Its IUPAC name is [3-(3-fluorophenyl)-4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [3-(3-fluorophenyl)-4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 42863805 |
| Molecular Formula | C28H28F2N4O3 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [3-(3-fluorophenyl)-4-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]pyrrolidin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CC(CN2CCN(c3ccc(F)cc3)CC2)C(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C28H28F2N4O3/c29-23-6-10-25(11-7-23)32-14-12-31(13-15-32)17-22-18-33(19-27(22)21-2-1-3-24(30)16-21)28(35)20-4-8-26(9-5-20)34(36)37/h1-11,16,22,27H,12-15,17-19H2 |
| InChIKey | HRXRYKDEZRORLA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 69.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|