C29H36N4O — CID 42864220
N-[[1-[[4-(dimethylamino)phenyl]methyl]-4-(4-methylphenyl)pyrrolidin-3-yl]methyl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 42864220) has the molecular formula C29H36N4O and a molecular weight of 456.63 g/mol. Its IUPAC name is N-[[1-[[4-(dimethylamino)phenyl]methyl]-4-(4-methylphenyl)pyrrolidin-3-yl]methyl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | N-[[1-[[4-(dimethylamino)phenyl]methyl]-4-(4-methylphenyl)pyrrolidin-3-yl]methyl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 42864220 |
| Molecular Formula | C29H36N4O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | N-[[1-[[4-(dimethylamino)phenyl]methyl]-4-(4-methylphenyl)pyrrolidin-3-yl]methyl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | CC(=O)N(Cc1cccnc1)CC1CN(Cc2ccc(N(C)C)cc2)CC1c1ccc(C)cc1 |
| InChI | InChI=1S/C29H36N4O/c1-22-7-11-26(12-8-22)29-21-32(17-24-9-13-28(14-10-24)31(3)4)19-27(29)20-33(23(2)34)18-25-6-5-15-30-16-25/h5-16,27,29H,17-21H2,1-4H3 |
| InChIKey | ZRXNXTWCWJAORA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|