C25H22N4O2 — CID 42868656
N-[4-[3-[(2-cyanophenyl)methyl]-2-oxo-1,3-diazinan-1-yl]phenyl]benzamide (PubChem CID 42868656) has the molecular formula C25H22N4O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is N-[4-[3-[(2-cyanophenyl)methyl]-2-oxo-1,3-diazinan-1-yl]phenyl]benzamide.
| Compound Name | N-[4-[3-[(2-cyanophenyl)methyl]-2-oxo-1,3-diazinan-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 42868656 |
| Molecular Formula | C25H22N4O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-[4-[3-[(2-cyanophenyl)methyl]-2-oxo-1,3-diazinan-1-yl]phenyl]benzamide |
| SMILES | N#Cc1ccccc1CN1CCCN(c2ccc(NC(=O)c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C25H22N4O2/c26-17-20-9-4-5-10-21(20)18-28-15-6-16-29(25(28)31)23-13-11-22(12-14-23)27-24(30)19-7-2-1-3-8-19/h1-5,7-14H,6,15-16,18H2,(H,27,30) |
| InChIKey | VRSSATROOOWNSD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |