C19H32N4O4S — CID 42869391
3-[4-(dimethylamino)phenyl]-2-methyl-N-(3-morpholin-4-ylpropyl)-1,2-oxazolidine-4-sulfonamide (PubChem CID 42869391) has the molecular formula C19H32N4O4S and a molecular weight of 412.56 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-2-methyl-N-(3-morpholin-4-ylpropyl)-1,2-oxazolidine-4-sulfonamide.
| Compound Name | 3-[4-(dimethylamino)phenyl]-2-methyl-N-(3-morpholin-4-ylpropyl)-1,2-oxazolidine-4-sulfonamide |
|---|---|
| PubChem CID | 42869391 |
| Molecular Formula | C19H32N4O4S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-2-methyl-N-(3-morpholin-4-ylpropyl)-1,2-oxazolidine-4-sulfonamide |
| SMILES | CN(C)c1ccc(C2C(S(=O)(=O)NCCCN3CCOCC3)CON2C)cc1 |
| InChI | InChI=1S/C19H32N4O4S/c1-21(2)17-7-5-16(6-8-17)19-18(15-27-22(19)3)28(24,25)20-9-4-10-23-11-13-26-14-12-23/h5-8,18-20H,4,9-15H2,1-3H3 |
| InChIKey | REAZAPWUNWQQST-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|