C23H24ClN3O4 — CID 42874002
4-chloro-N-[3-(3,4-dimethoxyphenyl)-5-(oxan-4-yl)-1H-pyrazol-4-yl]benzamide (PubChem CID 42874002) has the molecular formula C23H24ClN3O4 and a molecular weight of 441.92 g/mol. Its IUPAC name is 4-chloro-N-[3-(3,4-dimethoxyphenyl)-5-(oxan-4-yl)-1H-pyrazol-4-yl]benzamide.
| Compound Name | 4-chloro-N-[3-(3,4-dimethoxyphenyl)-5-(oxan-4-yl)-1H-pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 42874002 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-chloro-N-[3-(3,4-dimethoxyphenyl)-5-(oxan-4-yl)-1H-pyrazol-4-yl]benzamide |
| SMILES | COc1ccc(-c2n[nH]c(C3CCOCC3)c2NC(=O)c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C23H24ClN3O4/c1-29-18-8-5-16(13-19(18)30-2)21-22(20(26-27-21)14-9-11-31-12-10-14)25-23(28)15-3-6-17(24)7-4-15/h3-8,13-14H,9-12H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | PRHJXYTXYWKGAR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |