C20H20ClN3O3 — CID 42874186
4-chloro-N-[3-(2,4-dimethoxyphenyl)-5-ethyl-1H-pyrazol-4-yl]benzamide (PubChem CID 42874186) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is 4-chloro-N-[3-(2,4-dimethoxyphenyl)-5-ethyl-1H-pyrazol-4-yl]benzamide.
| Compound Name | 4-chloro-N-[3-(2,4-dimethoxyphenyl)-5-ethyl-1H-pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 42874186 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-chloro-N-[3-(2,4-dimethoxyphenyl)-5-ethyl-1H-pyrazol-4-yl]benzamide |
| SMILES | CCc1[nH]nc(-c2ccc(OC)cc2OC)c1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClN3O3/c1-4-16-19(22-20(25)12-5-7-13(21)8-6-12)18(24-23-16)15-10-9-14(26-2)11-17(15)27-3/h5-11H,4H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | LLHXHALMLOVQKW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |