C20H21FN4O3 — CID 42874376
1-[3-(2,4-dimethoxyphenyl)-5-ethyl-1H-pyrazol-4-yl]-3-(3-fluorophenyl)urea (PubChem CID 42874376) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is 1-[3-(2,4-dimethoxyphenyl)-5-ethyl-1H-pyrazol-4-yl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[3-(2,4-dimethoxyphenyl)-5-ethyl-1H-pyrazol-4-yl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 42874376 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-[3-(2,4-dimethoxyphenyl)-5-ethyl-1H-pyrazol-4-yl]-3-(3-fluorophenyl)urea |
| SMILES | CCc1[nH]nc(-c2ccc(OC)cc2OC)c1NC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C20H21FN4O3/c1-4-16-19(23-20(26)22-13-7-5-6-12(21)10-13)18(25-24-16)15-9-8-14(27-2)11-17(15)28-3/h5-11H,4H2,1-3H3,(H,24,25)(H2,22,23,26) |
| InChIKey | VLGUGQXEPLMXBW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |