C20H19F3N4O2 — CID 42687479
1-[5-ethyl-3-(3-methoxyphenyl)-1H-pyrazol-4-yl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 42687479) has the molecular formula C20H19F3N4O2 and a molecular weight of 404.39 g/mol. Its IUPAC name is 1-[5-ethyl-3-(3-methoxyphenyl)-1H-pyrazol-4-yl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[5-ethyl-3-(3-methoxyphenyl)-1H-pyrazol-4-yl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 42687479 |
| Molecular Formula | C20H19F3N4O2 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-[5-ethyl-3-(3-methoxyphenyl)-1H-pyrazol-4-yl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CCc1[nH]nc(-c2cccc(OC)c2)c1NC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F3N4O2/c1-3-16-18(17(27-26-16)12-5-4-6-15(11-12)29-2)25-19(28)24-14-9-7-13(8-10-14)20(21,22)23/h4-11H,3H2,1-2H3,(H,26,27)(H2,24,25,28) |
| InChIKey | RDOAIOARQSGACM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |