C18H17FN4O2 — CID 42687470
1-(4-fluorophenyl)-3-[3-(3-methoxyphenyl)-5-methyl-1H-pyrazol-4-yl]urea (PubChem CID 42687470) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[3-(3-methoxyphenyl)-5-methyl-1H-pyrazol-4-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[3-(3-methoxyphenyl)-5-methyl-1H-pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 42687470 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[3-(3-methoxyphenyl)-5-methyl-1H-pyrazol-4-yl]urea |
| SMILES | COc1cccc(-c2n[nH]c(C)c2NC(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H17FN4O2/c1-11-16(21-18(24)20-14-8-6-13(19)7-9-14)17(23-22-11)12-4-3-5-15(10-12)25-2/h3-10H,1-2H3,(H,22,23)(H2,20,21,24) |
| InChIKey | MMBCLQQWFKGDBT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |