C15H12ClN3OS — CID 42874274
3-chloro-N-(5-methyl-3-thiophen-3-yl-1H-pyrazol-4-yl)benzamide (PubChem CID 42874274) has the molecular formula C15H12ClN3OS and a molecular weight of 317.80 g/mol. Its IUPAC name is 3-chloro-N-(5-methyl-3-thiophen-3-yl-1H-pyrazol-4-yl)benzamide.
| Compound Name | 3-chloro-N-(5-methyl-3-thiophen-3-yl-1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 42874274 |
| Molecular Formula | C15H12ClN3OS |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 3-chloro-N-(5-methyl-3-thiophen-3-yl-1H-pyrazol-4-yl)benzamide |
| SMILES | Cc1[nH]nc(-c2ccsc2)c1NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H12ClN3OS/c1-9-13(14(19-18-9)11-5-6-21-8-11)17-15(20)10-3-2-4-12(16)7-10/h2-8H,1H3,(H,17,20)(H,18,19) |
| InChIKey | HGKCYJNQASZANX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |