C15H11F2N3OS — CID 42687284
3,5-difluoro-N-(5-methyl-3-thiophen-3-yl-1H-pyrazol-4-yl)benzamide (PubChem CID 42687284) has the molecular formula C15H11F2N3OS and a molecular weight of 319.34 g/mol. Its IUPAC name is 3,5-difluoro-N-(5-methyl-3-thiophen-3-yl-1H-pyrazol-4-yl)benzamide.
| Compound Name | 3,5-difluoro-N-(5-methyl-3-thiophen-3-yl-1H-pyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 42687284 |
| Molecular Formula | C15H11F2N3OS |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 3,5-difluoro-N-(5-methyl-3-thiophen-3-yl-1H-pyrazol-4-yl)benzamide |
| SMILES | Cc1[nH]nc(-c2ccsc2)c1NC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H11F2N3OS/c1-8-13(14(20-19-8)9-2-3-22-7-9)18-15(21)10-4-11(16)6-12(17)5-10/h2-7H,1H3,(H,18,21)(H,19,20) |
| InChIKey | IALTXTBJVZFULB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |