C15H13ClN4OS — CID 42687523
1-(4-chlorophenyl)-3-(5-methyl-3-thiophen-3-yl-1H-pyrazol-4-yl)urea (PubChem CID 42687523) has the molecular formula C15H13ClN4OS and a molecular weight of 332.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(5-methyl-3-thiophen-3-yl-1H-pyrazol-4-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(5-methyl-3-thiophen-3-yl-1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 42687523 |
| Molecular Formula | C15H13ClN4OS |
| Molecular Weight | 332.82 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(5-methyl-3-thiophen-3-yl-1H-pyrazol-4-yl)urea |
| SMILES | Cc1[nH]nc(-c2ccsc2)c1NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13ClN4OS/c1-9-13(14(20-19-9)10-6-7-22-8-10)18-15(21)17-12-4-2-11(16)3-5-12/h2-8H,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | UCBUOUUDOSYZRD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.82 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |