C16H15ClN4OS — CID 42687514
1-(4-chlorophenyl)-3-(5-ethyl-3-thiophen-2-yl-1H-pyrazol-4-yl)urea (PubChem CID 42687514) has the molecular formula C16H15ClN4OS and a molecular weight of 346.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(5-ethyl-3-thiophen-2-yl-1H-pyrazol-4-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(5-ethyl-3-thiophen-2-yl-1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 42687514 |
| Molecular Formula | C16H15ClN4OS |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(5-ethyl-3-thiophen-2-yl-1H-pyrazol-4-yl)urea |
| SMILES | CCc1[nH]nc(-c2cccs2)c1NC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN4OS/c1-2-12-14(15(21-20-12)13-4-3-9-23-13)19-16(22)18-11-7-5-10(17)6-8-11/h3-9H,2H2,1H3,(H,20,21)(H2,18,19,22) |
| InChIKey | JZCZPOPEWNCBET-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |