C16H13F2N3OS — CID 42687226
N-(5-ethyl-3-thiophen-2-yl-1H-pyrazol-4-yl)-3,5-difluorobenzamide (PubChem CID 42687226) has the molecular formula C16H13F2N3OS and a molecular weight of 333.36 g/mol. Its IUPAC name is N-(5-ethyl-3-thiophen-2-yl-1H-pyrazol-4-yl)-3,5-difluorobenzamide.
| Compound Name | N-(5-ethyl-3-thiophen-2-yl-1H-pyrazol-4-yl)-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 42687226 |
| Molecular Formula | C16H13F2N3OS |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-(5-ethyl-3-thiophen-2-yl-1H-pyrazol-4-yl)-3,5-difluorobenzamide |
| SMILES | CCc1[nH]nc(-c2cccs2)c1NC(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H13F2N3OS/c1-2-12-14(15(21-20-12)13-4-3-5-23-13)19-16(22)9-6-10(17)8-11(18)7-9/h3-8H,2H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | KPUBSQLREVNOSI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |