C21H20N6O4 — CID 42874593
5-[2-(2-nitrophenyl)acetyl]-N-(pyridin-3-ylmethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide (PubChem CID 42874593) has the molecular formula C21H20N6O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is 5-[2-(2-nitrophenyl)acetyl]-N-(pyridin-3-ylmethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide.
| Compound Name | 5-[2-(2-nitrophenyl)acetyl]-N-(pyridin-3-ylmethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 42874593 |
| Molecular Formula | C21H20N6O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 5-[2-(2-nitrophenyl)acetyl]-N-(pyridin-3-ylmethyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1n[nH]c2c1CN(C(=O)Cc1ccccc1[N+](=O)[O-])CC2 |
| InChI | InChI=1S/C21H20N6O4/c28-19(10-15-5-1-2-6-18(15)27(30)31)26-9-7-17-16(13-26)20(25-24-17)21(29)23-12-14-4-3-8-22-11-14/h1-6,8,11H,7,9-10,12-13H2,(H,23,29)(H,24,25) |
| InChIKey | WBKYKTLLUCLVOS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|