C26H28N6O4 — CID 46075998
1-[3-(4-benzylpiperazine-1-carbonyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-(2-nitrophenyl)ethanone (PubChem CID 46075998) has the molecular formula C26H28N6O4 and a molecular weight of 488.55 g/mol. Its IUPAC name is 1-[3-(4-benzylpiperazine-1-carbonyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-(2-nitrophenyl)ethanone.
| Compound Name | 1-[3-(4-benzylpiperazine-1-carbonyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-(2-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 46075998 |
| Molecular Formula | C26H28N6O4 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 1-[3-(4-benzylpiperazine-1-carbonyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-(2-nitrophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])N1CCc2[nH]nc(C(=O)N3CCN(Cc4ccccc4)CC3)c2C1 |
| InChI | InChI=1S/C26H28N6O4/c33-24(16-20-8-4-5-9-23(20)32(35)36)31-11-10-22-21(18-31)25(28-27-22)26(34)30-14-12-29(13-15-30)17-19-6-2-1-3-7-19/h1-9H,10-18H2,(H,27,28) |
| InChIKey | SKJVHPLYPLMJMT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|