C20H21N3O — CID 145116778
1-[3-[(3E)-hexa-1,3,5-trien-3-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-phenylethanone (PubChem CID 145116778) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-[3-[(3E)-hexa-1,3,5-trien-3-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-phenylethanone.
| Compound Name | 1-[3-[(3E)-hexa-1,3,5-trien-3-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 145116778 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1-[3-[(3E)-hexa-1,3,5-trien-3-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-phenylethanone |
| SMILES | C=C/C=C(\C=C)c1n[nH]c2c1CN(C(=O)Cc1ccccc1)CC2 |
| InChI | InChI=1S/C20H21N3O/c1-3-8-16(4-2)20-17-14-23(12-11-18(17)21-22-20)19(24)13-15-9-6-5-7-10-15/h3-10H,1-2,11-14H2,(H,21,22)/b16-8+ |
| InChIKey | FSCHUPYYSUIVTC-LZYBPNLTSA-N |
| XLogP | 3.29 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|