C23H31N3O2 — CID 145116839
ethene;2-[(3E,5Z)-hepta-3,5-dien-3-yl]oxy-1-[3-[(3E)-hexa-1,3,5-trien-3-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone (PubChem CID 145116839) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is ethene;2-[(3E,5Z)-hepta-3,5-dien-3-yl]oxy-1-[3-[(3E)-hexa-1,3,5-trien-3-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone.
| Compound Name | ethene;2-[(3E,5Z)-hepta-3,5-dien-3-yl]oxy-1-[3-[(3E)-hexa-1,3,5-trien-3-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 145116839 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | ethene;2-[(3E,5Z)-hepta-3,5-dien-3-yl]oxy-1-[3-[(3E)-hexa-1,3,5-trien-3-yl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone |
| SMILES | C=C.C=C/C=C(\C=C)c1n[nH]c2c1CN(C(=O)CO/C(=C/C=C\C)CC)CC2 |
| InChI | InChI=1S/C21H27N3O2.C2H4/c1-5-9-11-17(8-4)26-15-20(25)24-13-12-19-18(14-24)21(23-22-19)16(7-3)10-6-2;1-2/h5-7,9-11H,2-3,8,12-15H2,1,4H3,(H,22,23);1-2H2/b9-5-,16-10+,17-11+; |
| InChIKey | PGWRRXPOBPSHMF-RNCQURGWSA-N |
| XLogP | 4.74 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|