C18H16Cl2N4O — CID 144720479
(2,3-dichloro-4-pyridinyl)-[3-[(3E)-hexa-1,3,5-trien-3-yl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]methanone (PubChem CID 144720479) has the molecular formula C18H16Cl2N4O and a molecular weight of 375.26 g/mol. Its IUPAC name is (2,3-dichloro-4-pyridinyl)-[3-[(3E)-hexa-1,3,5-trien-3-yl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]methanone.
| Compound Name | (2,3-dichloro-4-pyridinyl)-[3-[(3E)-hexa-1,3,5-trien-3-yl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 144720479 |
| Molecular Formula | C18H16Cl2N4O |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (2,3-dichloro-4-pyridinyl)-[3-[(3E)-hexa-1,3,5-trien-3-yl]-1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl]methanone |
| SMILES | C=C/C=C(\C=C)c1n[nH]c2c1CCN(C(=O)c1ccnc(Cl)c1Cl)C2 |
| InChI | InChI=1S/C18H16Cl2N4O/c1-3-5-11(4-2)16-12-7-9-24(10-14(12)22-23-16)18(25)13-6-8-21-17(20)15(13)19/h3-6,8H,1-2,7,9-10H2,(H,22,23)/b11-5+ |
| InChIKey | HZBTVLHSURXWRE-VZUCSPMQSA-N |
| XLogP | 4.07 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|