C30H26ClN5O3 — CID 42874835
1-[4-[6-benzyl-3-(3-phenoxyphenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]-2-chloroethanone (PubChem CID 42874835) has the molecular formula C30H26ClN5O3 and a molecular weight of 540.02 g/mol. Its IUPAC name is 1-[4-[6-benzyl-3-(3-phenoxyphenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]-2-chloroethanone.
| Compound Name | 1-[4-[6-benzyl-3-(3-phenoxyphenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]-2-chloroethanone |
|---|---|
| PubChem CID | 42874835 |
| Molecular Formula | C30H26ClN5O3 |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 1-[4-[6-benzyl-3-(3-phenoxyphenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]piperazin-1-yl]-2-chloroethanone |
| SMILES | O=C(CCl)N1CCN(c2nc(Cc3ccccc3)nc3onc(-c4cccc(Oc5ccccc5)c4)c23)CC1 |
| InChI | InChI=1S/C30H26ClN5O3/c31-20-26(37)35-14-16-36(17-15-35)29-27-28(22-10-7-13-24(19-22)38-23-11-5-2-6-12-23)34-39-30(27)33-25(32-29)18-21-8-3-1-4-9-21/h1-13,19H,14-18,20H2 |
| InChIKey | LEMSUFPMQSJVFV-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 84.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|