C23H21N3O3 — CID 42876569
N-benzyl-6-(2,6-dimethoxyphenyl)imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 42876569) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-benzyl-6-(2,6-dimethoxyphenyl)imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-benzyl-6-(2,6-dimethoxyphenyl)imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 42876569 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-benzyl-6-(2,6-dimethoxyphenyl)imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | COc1cccc(OC)c1-c1ccc2nc(C(=O)NCc3ccccc3)cn2c1 |
| InChI | InChI=1S/C23H21N3O3/c1-28-19-9-6-10-20(29-2)22(19)17-11-12-21-25-18(15-26(21)14-17)23(27)24-13-16-7-4-3-5-8-16/h3-12,14-15H,13H2,1-2H3,(H,24,27) |
| InChIKey | MKJYIRNFTBMUNU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |